CAS 54906-38-6 appears in our catalog under these names: 1-Phenyl-1H-pyrazole-4-carbothioamide, 95%, 1-Phenyl-1H-pyrazole-4-carbothioamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1-phenylpyrazole-4-carbothioamide (CAS 54906-38-6) is a chemical compound with the molecular formula C10H9N3S and a molecular weight of 203.27 g/mol. IUPAC name: 1-phenylpyrazole-4-carbothioamide. InChIKey: IOSFBUOSEDGEGN-UHFFFAOYSA-N.
| Molecular formula | C10H9N3S |
|---|---|
| Molecular weight | 203.27 g/mol |
| IUPAC name | 1-phenylpyrazole-4-carbothioamide |
| InChIKey | IOSFBUOSEDGEGN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=C(C=N2)C(=S)N |
Computed by PubChem (NCBI)