Products 1049981-41-0
CAS 1049981-41-0 appears in our catalog under these names: (2S,4R)-4-(3,4-Dichlorobenzyl)pyrrolidine-2-carboxylic acid, 95%, (2S,4R)-4-(3,4-Dichlorobenzyl)pyrrolidine-2-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
(2S,4R)-4-[(3,4-dichlorophenyl)methyl]pyrrolidine-2-carboxylic acid (CAS 1049981-41-0) is a chemical compound with the molecular formula C12H13Cl2NO2 and a molecular weight of 274.14 g/mol. IUPAC name: (2S,4R)-4-[(3,4-dichlorophenyl)methyl]pyrrolidine-2-carboxylic acid. InChIKey: UELMJLOCNYHTQH-KCJUWKMLSA-N.
| Molecular formula | C12H13Cl2NO2 |
|---|---|
| Molecular weight | 274.14 g/mol |
| IUPAC name | (2S,4R)-4-[(3,4-dichlorophenyl)methyl]pyrrolidine-2-carboxylic acid |
| InChIKey | UELMJLOCNYHTQH-KCJUWKMLSA-N |
| SMILES | C1[C@H](CN[C@@H]1C(=O)O)CC2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)