Products 1837137-61-7
CAS 1837137-61-7 is the registry number for 1-(2,4-Dichlorobenzyl)pyrrolidine-3-carboxylic acid hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(2,4-dichlorophenyl)methyl]pyrrolidine-3-carboxylic acid (CAS 1837137-61-7) is a chemical compound with the molecular formula C12H13Cl2NO2 and a molecular weight of 274.14 g/mol. IUPAC name: 1-[(2,4-dichlorophenyl)methyl]pyrrolidine-3-carboxylic acid. InChIKey: ZUESXEMGHWMUNF-UHFFFAOYSA-N.
| Molecular formula | C12H13Cl2NO2 |
|---|---|
| Molecular weight | 274.14 g/mol |
| IUPAC name | 1-[(2,4-dichlorophenyl)methyl]pyrrolidine-3-carboxylic acid |
| InChIKey | ZUESXEMGHWMUNF-UHFFFAOYSA-N |
| SMILES | C1CN(CC1C(=O)O)CC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)