CAS 1049983-71-2 is the registry number for 4-chloro-1-((4-(3-phenylprop-2-enyl)piperazinyl)sulfonyl)benzene. Offered by: Biosynth. Available pack sizes: 250mg.
1-(4-chlorophenyl)sulfonyl-4-(3-phenylprop-2-enyl)piperazine (CAS 1049983-71-2) is a chemical compound with the molecular formula C19H21ClN2O2S and a molecular weight of 376.9 g/mol. IUPAC name: 1-(4-chlorophenyl)sulfonyl-4-(3-phenylprop-2-enyl)piperazine. InChIKey: NRMPKYKDLBLXKC-UHFFFAOYSA-N.
| Molecular formula | C19H21ClN2O2S |
|---|---|
| Molecular weight | 376.9 g/mol |
| IUPAC name | 1-(4-chlorophenyl)sulfonyl-4-(3-phenylprop-2-enyl)piperazine |
| InChIKey | NRMPKYKDLBLXKC-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CC=CC2=CC=CC=C2)S(=O)(=O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)