CAS 93100-99-3 appears in our catalog under these names: W-15, >95% (HPLC), W–15. Offered by: TRC, GLPBio. Available pack sizes: 10mg, 1mg, 5mg.
4-chloro-N-[1-(2-phenylethyl)piperidin-2-ylidene]benzenesulfonamide (CAS 93100-99-3) is a chemical compound with the molecular formula C19H21ClN2O2S and a molecular weight of 376.9 g/mol. IUPAC name: 4-chloro-N-[1-(2-phenylethyl)piperidin-2-ylidene]benzenesulfonamide. InChIKey: VJHXSSVOCOBVMI-UHFFFAOYSA-N.
| Molecular formula | C19H21ClN2O2S |
|---|---|
| Molecular weight | 376.9 g/mol |
| IUPAC name | 4-chloro-N-[1-(2-phenylethyl)piperidin-2-ylidene]benzenesulfonamide |
| InChIKey | VJHXSSVOCOBVMI-UHFFFAOYSA-N |
| SMILES | C1CCN(C(=NS(=O)(=O)C2=CC=C(C=C2)Cl)C1)CCC3=CC=CC=C3 |
Computed by PubChem (NCBI)