Products 105-75-9
CAS 105-75-9 appears in our catalog under these names: Dibutyl fumarate, 95%, Dibutyl Fumarate, Dibutyl Fumarate, >98.0%(GC), Dibutyl fumarate 98%, Dibutyl fumarate, 95%, 95%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 5g, 25g, 100g, 1kg, 500g, 1000g, 200g, 5kg.
Dibutyl (E)-but-2-enedioate (CAS 105-75-9) is a chemical compound with the molecular formula C12H20O4 and a molecular weight of 228.28 g/mol. IUPAC name: dibutyl (E)-but-2-enedioate. InChIKey: JBSLOWBPDRZSMB-BQYQJAHWSA-N.
| Molecular formula | C12H20O4 |
|---|---|
| Molecular weight | 228.28 g/mol |
| IUPAC name | dibutyl (E)-but-2-enedioate |
| InChIKey | JBSLOWBPDRZSMB-BQYQJAHWSA-N |
| SMILES | CCCCOC(=O)/C=C/C(=O)OCCCC |
Computed by PubChem (NCBI)