Products 7283-69-4
CAS 7283-69-4 appears in our catalog under these names: Diisobutyl fumarate, 98%, Diisobutyl Fumarate, Diisobutyl Fumarate, >98.0%(GC), Diisobutyl fumarate, Diisobutyl fumarate, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Sigma-Aldrich. Available pack sizes: 1g, 100g, 25g, 5g, 500g, 100ML, 100MG, 1x1000mg.
Bis(2-methylpropyl) (E)-but-2-enedioate (CAS 7283-69-4) is a chemical compound with the molecular formula C12H20O4 and a molecular weight of 228.28 g/mol. IUPAC name: bis(2-methylpropyl) (E)-but-2-enedioate. InChIKey: RSRICHZMFPHXLE-AATRIKPKSA-N.
| Molecular formula | C12H20O4 |
|---|---|
| Molecular weight | 228.28 g/mol |
| IUPAC name | bis(2-methylpropyl) (E)-but-2-enedioate |
| InChIKey | RSRICHZMFPHXLE-AATRIKPKSA-N |
| SMILES | CC(C)COC(=O)/C=C/C(=O)OCC(C)C |
Computed by PubChem (NCBI)
Synonyms:
Diisobutyl fumarate, FUMARIC ACID, DIISOBUTYL ESTER, 2-Butenedioic acid (E)-, bis(2-methylpropyl) ester, Diisobutylester kyseliny fumarove, Diisobutylester kyseliny fumarove [Czech], Diisobutyl (2E)-2-butenedioate, 2-Butenedioic acid, bis(2-methylpropyl) ester, (E)-, 2-Butenedioic acid (E), di-2-methylpropyl ester, 2-Butenedioic acid (E)-, bis(2-methylpropyl) ester (9CI), RSRICHZMFPHXLE-AATRIKPKSA-N