CAS 10502-44-0 appears in our catalog under these names: 4–Methoxymandelic acid, DL-4-Methoxymandelic Acid, >98.0%(HPLC)(T), 4-Methoxymandelic acid 98%, 2-Hydroxy-2-(4-methoxyphenyl)acetic acid, 98%, 98%, DL-4-Methoxymandelic acid, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 250mg, 1g, 10g.
2-hydroxy-2-(4-methoxyphenyl)acetic acid (CAS 10502-44-0) is a chemical compound with the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. IUPAC name: 2-hydroxy-2-(4-methoxyphenyl)acetic acid. InChIKey: ITECRQOOEQWFPE-UHFFFAOYSA-N.
| Molecular formula | C9H10O4 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | 2-hydroxy-2-(4-methoxyphenyl)acetic acid |
| InChIKey | ITECRQOOEQWFPE-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(C(=O)O)O |
Computed by PubChem (NCBI)