CAS 1050446-94-0 appears in our catalog under these names: D-1-N-Cbz-nipecotamide, 95%, (R)-Benzyl 3-carbamoylpiperidine-1-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
Benzyl (3R)-3-carbamoylpiperidine-1-carboxylate (CAS 1050446-94-0) is a chemical compound with the molecular formula C14H18N2O3 and a molecular weight of 262.30 g/mol. IUPAC name: benzyl (3R)-3-carbamoylpiperidine-1-carboxylate. InChIKey: JVNTYSRHYYSZEM-GFCCVEGCSA-N.
| Molecular formula | C14H18N2O3 |
|---|---|
| Molecular weight | 262.30 g/mol |
| IUPAC name | benzyl (3R)-3-carbamoylpiperidine-1-carboxylate |
| InChIKey | JVNTYSRHYYSZEM-GFCCVEGCSA-N |
| SMILES | C1C[C@H](CN(C1)C(=O)OCC2=CC=CC=C2)C(=O)N |
Computed by PubChem (NCBI)