CAS 1050479-95-2 appears in our catalog under these names: tert-Butyl[(3-methyl-2-thienyl)methyl]amine hydrochloride, 95%, tert-Butyl((3-methyl-2-thienyl)methyl)amine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-methyl-N-[(3-methylthiophen-2-yl)methyl]propan-2-amine;hydrochloride (CAS 1050479-95-2) is a chemical compound with the molecular formula C10H18ClNS and a molecular weight of 219.78 g/mol. IUPAC name: 2-methyl-N-[(3-methylthiophen-2-yl)methyl]propan-2-amine;hydrochloride. InChIKey: IIDHRXYQBMFEFH-UHFFFAOYSA-N.
| Molecular formula | C10H18ClNS |
|---|---|
| Molecular weight | 219.78 g/mol |
| IUPAC name | 2-methyl-N-[(3-methylthiophen-2-yl)methyl]propan-2-amine;hydrochloride |
| InChIKey | IIDHRXYQBMFEFH-UHFFFAOYSA-N |
| SMILES | CC1=C(SC=C1)CNC(C)(C)C.Cl |
Computed by PubChem (NCBI)