CAS 2567556-28-7 is the registry number for 2,5-Diisopropylthiophen-3-amine hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,5-di(propan-2-yl)thiophen-3-amine;hydrochloride (CAS 2567556-28-7) is a chemical compound with the molecular formula C10H18ClNS and a molecular weight of 219.78 g/mol. IUPAC name: 2,5-di(propan-2-yl)thiophen-3-amine;hydrochloride. InChIKey: MVEWCULFASBIBG-UHFFFAOYSA-N.
| Molecular formula | C10H18ClNS |
|---|---|
| Molecular weight | 219.78 g/mol |
| IUPAC name | 2,5-di(propan-2-yl)thiophen-3-amine;hydrochloride |
| InChIKey | MVEWCULFASBIBG-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(S1)C(C)C)N.Cl |
Computed by PubChem (NCBI)