CAS 1050587-25-1 is the registry number for (4-Benzyl-1,4-diazepan-1-yl)(5-bromofuran-2-yl)methanone, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-benzyl-1,4-diazepan-1-yl)-(5-bromofuran-2-yl)methanone (CAS 1050587-25-1) is a chemical compound with the molecular formula C17H19BrN2O2 and a molecular weight of 363.2 g/mol. IUPAC name: (4-benzyl-1,4-diazepan-1-yl)-(5-bromofuran-2-yl)methanone. InChIKey: HYDIWVOJYPOJFY-UHFFFAOYSA-N.
| Molecular formula | C17H19BrN2O2 |
|---|---|
| Molecular weight | 363.2 g/mol |
| IUPAC name | (4-benzyl-1,4-diazepan-1-yl)-(5-bromofuran-2-yl)methanone |
| InChIKey | HYDIWVOJYPOJFY-UHFFFAOYSA-N |
| SMILES | C1CN(CCN(C1)C(=O)C2=CC=C(O2)Br)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)