Products 2504202-27-9

CAS 2504202-27-9 is the registry number for [(5-Bromo-pyridin-3-yl)-phenyl-methyl]-carbamic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(5-bromo-3-pyridinyl)-phenylmethyl]carbamate (CAS 2504202-27-9) is a chemical compound with the molecular formula C17H19BrN2O2 and a molecular weight of 363.2 g/mol. IUPAC name: tert-butyl N-[(5-bromo-3-pyridinyl)-phenylmethyl]carbamate. InChIKey: MUXVFNGGXAHXBZ-UHFFFAOYSA-N.

Identity
Molecular formulaC17H19BrN2O2
Molecular weight363.2 g/mol
IUPAC nametert-butyl N-[(5-bromo-3-pyridinyl)-phenylmethyl]carbamate
InChIKeyMUXVFNGGXAHXBZ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC(C1=CC=CC=C1)C2=CC(=CN=C2)Br

Computed by PubChem (NCBI)