Products 1050646-75-7
CAS 1050646-75-7 is the registry number for Darifenacin(acetic Acid) Des-(5-Ethyl-2,3-dihydrobenzofuran) (Darifenacin Impurity). Offered by: TRC. Available pack sizes: 500mg.
2,2-diphenyl-2-[(3S)-pyrrolidin-3-yl]acetic acid (CAS 1050646-75-7) is a chemical compound with the molecular formula C18H19NO2 and a molecular weight of 281.3 g/mol. IUPAC name: 2,2-diphenyl-2-[(3S)-pyrrolidin-3-yl]acetic acid. InChIKey: VUZKRGHULSJHKU-MRXNPFEDSA-N.
| Molecular formula | C18H19NO2 |
|---|---|
| Molecular weight | 281.3 g/mol |
| IUPAC name | 2,2-diphenyl-2-[(3S)-pyrrolidin-3-yl]acetic acid |
| InChIKey | VUZKRGHULSJHKU-MRXNPFEDSA-N |
| SMILES | C1CNC[C@@H]1C(C2=CC=CC=C2)(C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)