CAS 1050883-84-5 is the registry number for 3-Chloro-N-(phenyl(thiophen-2-yl)methyl)propanamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-chloro-N-[phenyl(thiophen-2-yl)methyl]propanamide (CAS 1050883-84-5) is a chemical compound with the molecular formula C14H14ClNOS and a molecular weight of 279.8 g/mol. IUPAC name: 3-chloro-N-[phenyl(thiophen-2-yl)methyl]propanamide. InChIKey: ABDSLCVYKYKTOH-UHFFFAOYSA-N.
| Molecular formula | C14H14ClNOS |
|---|---|
| Molecular weight | 279.8 g/mol |
| IUPAC name | 3-chloro-N-[phenyl(thiophen-2-yl)methyl]propanamide |
| InChIKey | ABDSLCVYKYKTOH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CS2)NC(=O)CCCl |
Computed by PubChem (NCBI)