CAS 51687-55-9 is the registry number for De-diazepin-2-one Clotiazepam. Offered by: TRC. Available pack sizes: 25mg.
(2-chlorophenyl)-[5-ethyl-2-(methylamino)thiophen-3-yl]methanone (CAS 51687-55-9) is a chemical compound with the molecular formula C14H14ClNOS and a molecular weight of 279.8 g/mol. IUPAC name: (2-chlorophenyl)-[5-ethyl-2-(methylamino)thiophen-3-yl]methanone. InChIKey: GONPMZRYALNCAZ-UHFFFAOYSA-N.
| Molecular formula | C14H14ClNOS |
|---|---|
| Molecular weight | 279.8 g/mol |
| IUPAC name | (2-chlorophenyl)-[5-ethyl-2-(methylamino)thiophen-3-yl]methanone |
| InChIKey | GONPMZRYALNCAZ-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=C(S1)NC)C(=O)C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)