CAS 105090-72-0 appears in our catalog under these names: 3–AZIDO–3–METHYLBUTANOIC ACID, 3-Azido-3-methylbutanoic acid. Offered by: GLPBio, Biosynth. Available pack sizes: 250mg, 0,5g, 50mg.
3-azido-3-methylbutanoic acid (CAS 105090-72-0) is a chemical compound with the molecular formula C5H9N3O2 and a molecular weight of 143.14 g/mol. IUPAC name: 3-azido-3-methylbutanoic acid. InChIKey: HGBYXYUFWAJPSP-UHFFFAOYSA-N.
| Molecular formula | C5H9N3O2 |
|---|---|
| Molecular weight | 143.14 g/mol |
| IUPAC name | 3-azido-3-methylbutanoic acid |
| InChIKey | HGBYXYUFWAJPSP-UHFFFAOYSA-N |
| SMILES | CC(C)(CC(=O)O)N=[N+]=[N-] |
Computed by PubChem (NCBI)