Products 1050910-45-6
CAS 1050910-45-6 is the registry number for 1-Methyl-5-(methylcarbamoyl)-1H-pyrrole-3-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
1-methyl-5-(methylcarbamoyl)pyrrole-3-sulfonyl chloride (CAS 1050910-45-6) is a chemical compound with the molecular formula C7H9ClN2O3S and a molecular weight of 236.68 g/mol. IUPAC name: 1-methyl-5-(methylcarbamoyl)pyrrole-3-sulfonyl chloride. InChIKey: AUZVCWXHUZTUTG-UHFFFAOYSA-N.
| Molecular formula | C7H9ClN2O3S |
|---|---|
| Molecular weight | 236.68 g/mol |
| IUPAC name | 1-methyl-5-(methylcarbamoyl)pyrrole-3-sulfonyl chloride |
| InChIKey | AUZVCWXHUZTUTG-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC(=CN1C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)