Products 929863-92-3
CAS 929863-92-3 is the registry number for N-(4-Chloro-1,1-dioxidotetrahydrothiophen-3-yl)-2-cyanoacetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(4-chloro-1,1-dioxothiolan-3-yl)-2-cyanoacetamide (CAS 929863-92-3) is a chemical compound with the molecular formula C7H9ClN2O3S and a molecular weight of 236.68 g/mol. IUPAC name: N-(4-chloro-1,1-dioxothiolan-3-yl)-2-cyanoacetamide. InChIKey: NNYBRHRSTCXCNT-UHFFFAOYSA-N.
| Molecular formula | C7H9ClN2O3S |
|---|---|
| Molecular weight | 236.68 g/mol |
| IUPAC name | N-(4-chloro-1,1-dioxothiolan-3-yl)-2-cyanoacetamide |
| InChIKey | NNYBRHRSTCXCNT-UHFFFAOYSA-N |
| SMILES | C1C(C(CS1(=O)=O)Cl)NC(=O)CC#N |
Computed by PubChem (NCBI)