Products 105108-20-1
CAS 105108-20-1 appears in our catalog under these names: 4-Hydroxy-1,4a-dimethyl-7-prop-1-en-2-yl-3,4,5,6,7,8-hexahydronaphthalen-2-one, Ligucyperonol, Ligucyperonol, ≥98%. Offered by: Biosynth, MedChemExpress, Chemat. Available pack sizes: 5mg, 2mg, 10mg, 25mg, 50mg, 1 mg, 5 mg.
(4R,4aR,7R)-4-hydroxy-1,4a-dimethyl-7-prop-1-en-2-yl-3,4,5,6,7,8-hexahydronaphthalen-2-one (CAS 105108-20-1) is a chemical compound with the molecular formula C15H22O2 and a molecular weight of 234.33 g/mol. IUPAC name: (4R,4aR,7R)-4-hydroxy-1,4a-dimethyl-7-prop-1-en-2-yl-3,4,5,6,7,8-hexahydronaphthalen-2-one. InChIKey: MROVETGJOLYNJI-KCPJHIHWSA-N.
| Molecular formula | C15H22O2 |
|---|---|
| Molecular weight | 234.33 g/mol |
| IUPAC name | (4R,4aR,7R)-4-hydroxy-1,4a-dimethyl-7-prop-1-en-2-yl-3,4,5,6,7,8-hexahydronaphthalen-2-one |
| InChIKey | MROVETGJOLYNJI-KCPJHIHWSA-N |
| SMILES | CC1=C2C[C@@H](CC[C@]2([C@@H](CC1=O)O)C)C(=C)C |
Computed by PubChem (NCBI)