CAS 10512-93-3 appears in our catalog under these names: Z-Val-ONp, 96%, Z-Val-ONp, 98%, Z–Val–ONp, Z-L-Val-ONp. Offered by: Combi-blocks, AmBeed, GLPBio, Iris Biotech. Available pack sizes: 1g, 25g, 100g, 500g, 5g.
(4-nitrophenyl) (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate (CAS 10512-93-3) is a chemical compound with the molecular formula C19H20N2O6 and a molecular weight of 372.4 g/mol. IUPAC name: (4-nitrophenyl) (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate. InChIKey: GLFONBITBIYJPS-KRWDZBQOSA-N.
| Molecular formula | C19H20N2O6 |
|---|---|
| Molecular weight | 372.4 g/mol |
| IUPAC name | (4-nitrophenyl) (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
| InChIKey | GLFONBITBIYJPS-KRWDZBQOSA-N |
| SMILES | CC(C)[C@@H](C(=O)OC1=CC=C(C=C1)[N+](=O)[O-])NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)