CAS 10512-94-4 is the registry number for Z-D-Val-ONp. Offered by: Creative Peptides. Available pack sizes: 5g, 25g.
(4-nitrophenyl) (2R)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate (CAS 10512-94-4) is a chemical compound with the molecular formula C19H20N2O6 and a molecular weight of 372.4 g/mol. IUPAC name: (4-nitrophenyl) (2R)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate. InChIKey: GLFONBITBIYJPS-QGZVFWFLSA-N.
| Molecular formula | C19H20N2O6 |
|---|---|
| Molecular weight | 372.4 g/mol |
| IUPAC name | (4-nitrophenyl) (2R)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
| InChIKey | GLFONBITBIYJPS-QGZVFWFLSA-N |
| SMILES | CC(C)[C@H](C(=O)OC1=CC=C(C=C1)[N+](=O)[O-])NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)