CAS 105125-00-6 appears in our catalog under these names: 3'-Bromo-2,2':5',2''-terthiophene, 95%, 3'-Bromo-2,2':5',2''-terthiophene, 97%, 3'–Bromo–2,2':5',2''–terthiophene, 3'-Bromo-2,2':5',2''-terthiophene, >97.0%(GC), 3'-Bromo-2,2':5',2''-terthiophene, ≥97%, ≥97%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 1g, 5g, 250mg.
3-bromo-2,5-dithiophen-2-ylthiophene (CAS 105125-00-6) is a chemical compound with the molecular formula C12H7BrS3 and a molecular weight of 327.3 g/mol. IUPAC name: 3-bromo-2,5-dithiophen-2-ylthiophene. InChIKey: FGBHDLKMGUOJBA-UHFFFAOYSA-N.
| Molecular formula | C12H7BrS3 |
|---|---|
| Molecular weight | 327.3 g/mol |
| IUPAC name | 3-bromo-2,5-dithiophen-2-ylthiophene |
| InChIKey | FGBHDLKMGUOJBA-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC(=C(S2)C3=CC=CS3)Br |
Computed by PubChem (NCBI)