CAS 94581-95-0 is the registry number for 2-BROMO-TERTHIOPHENE, 95% (stabilized with Cu+HQ+MgO). Offered by: Fluorochem. Available pack sizes: 250mg.
2-bromo-5-(5-thiophen-2-ylthiophen-2-yl)thiophene (CAS 94581-95-0) is a chemical compound with the molecular formula C12H7BrS3 and a molecular weight of 327.3 g/mol. IUPAC name: 2-bromo-5-(5-thiophen-2-ylthiophen-2-yl)thiophene. InChIKey: HNMURGGRBMOMLO-UHFFFAOYSA-N.
| Molecular formula | C12H7BrS3 |
|---|---|
| Molecular weight | 327.3 g/mol |
| IUPAC name | 2-bromo-5-(5-thiophen-2-ylthiophen-2-yl)thiophene |
| InChIKey | HNMURGGRBMOMLO-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC=C(S2)C3=CC=C(S3)Br |
Computed by PubChem (NCBI)