CAS 105130-26-5 appears in our catalog under these names: 4-(2-Pyrimidinyloxy)aniline 95%, 4-(2-Pyrimidinyloxy)aniline, 95%, 95%, 4-(2-Pyrimidinyloxy)aniline, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg, 10g.
4-pyrimidin-2-yloxyaniline (CAS 105130-26-5) is a chemical compound with the molecular formula C10H9N3O and a molecular weight of 187.20 g/mol. IUPAC name: 4-pyrimidin-2-yloxyaniline. InChIKey: OYPOTUTZLSXURN-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O |
|---|---|
| Molecular weight | 187.20 g/mol |
| IUPAC name | 4-pyrimidin-2-yloxyaniline |
| InChIKey | OYPOTUTZLSXURN-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N=C1)OC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)