CAS 1051368-96-7 is the registry number for N-[1-(3-Aminophenyl)ethyl]acetamide compound with sulfuric acid (1:1), 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
N-[1-(3-aminophenyl)ethyl]acetamide;sulfuric acid (CAS 1051368-96-7) is a chemical compound with the molecular formula C10H16N2O5S and a molecular weight of 276.31 g/mol. IUPAC name: N-[1-(3-aminophenyl)ethyl]acetamide;sulfuric acid. InChIKey: ASOPKFSIFGFZFE-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O5S |
|---|---|
| Molecular weight | 276.31 g/mol |
| IUPAC name | N-[1-(3-aminophenyl)ethyl]acetamide;sulfuric acid |
| InChIKey | ASOPKFSIFGFZFE-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC=C1)N)NC(=O)C.OS(=O)(=O)O |
Computed by PubChem (NCBI)