Products 1945956-34-2
CAS 1945956-34-2 is the registry number for tert-Butyl 4-(((methylsulfonyl)oxy)methyl)-1H-pyrazole-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 4-(methylsulfonyloxymethyl)pyrazole-1-carboxylate (CAS 1945956-34-2) is a chemical compound with the molecular formula C10H16N2O5S and a molecular weight of 276.31 g/mol. IUPAC name: tert-butyl 4-(methylsulfonyloxymethyl)pyrazole-1-carboxylate. InChIKey: LYRNWURZTJTNLL-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O5S |
|---|---|
| Molecular weight | 276.31 g/mol |
| IUPAC name | tert-butyl 4-(methylsulfonyloxymethyl)pyrazole-1-carboxylate |
| InChIKey | LYRNWURZTJTNLL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C=N1)COS(=O)(=O)C |
Computed by PubChem (NCBI)