CAS 1051369-20-0 is the registry number for 10,11-Dihydrodibenzo[b,f]oxepine-1,3-diamine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5,6-dihydrobenzo[b][1]benzoxepine-2,4-diamine;dihydrochloride (CAS 1051369-20-0) is a chemical compound with the molecular formula C14H16Cl2N2O and a molecular weight of 299.2 g/mol. IUPAC name: 5,6-dihydrobenzo[b][1]benzoxepine-2,4-diamine;dihydrochloride. InChIKey: GPELOEZZAOHIKD-UHFFFAOYSA-N.
| Molecular formula | C14H16Cl2N2O |
|---|---|
| Molecular weight | 299.2 g/mol |
| IUPAC name | 5,6-dihydrobenzo[b][1]benzoxepine-2,4-diamine;dihydrochloride |
| InChIKey | GPELOEZZAOHIKD-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(C=C2OC3=CC=CC=C31)N)N.Cl.Cl |
Computed by PubChem (NCBI)