CAS 20955-94-6 appears in our catalog under these names: 1-(4-Chlorobenzyl)-1-(4-methoxyphenyl)hydrazine hydrochloride, 98%, 98%, 1-(4-Chlorobenzyl)-1-(4-methoxyphenyl)hydrazine hydrochloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-[(4-chlorophenyl)methyl]-1-(4-methoxyphenyl)hydrazine;hydrochloride (CAS 20955-94-6) is a chemical compound with the molecular formula C14H16Cl2N2O and a molecular weight of 299.2 g/mol. IUPAC name: 1-[(4-chlorophenyl)methyl]-1-(4-methoxyphenyl)hydrazine;hydrochloride. InChIKey: NDCIXQARVUNTKN-UHFFFAOYSA-N.
| Molecular formula | C14H16Cl2N2O |
|---|---|
| Molecular weight | 299.2 g/mol |
| IUPAC name | 1-[(4-chlorophenyl)methyl]-1-(4-methoxyphenyl)hydrazine;hydrochloride |
| InChIKey | NDCIXQARVUNTKN-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N(CC2=CC=C(C=C2)Cl)N.Cl |
Computed by PubChem (NCBI)