Products 1051383-06-2
CAS 1051383-06-2 is the registry number for 6-Nitrospiro[chroman-2,4'-piperidin]-4-one hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
6-nitrospiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride (CAS 1051383-06-2) is a chemical compound with the molecular formula C13H15ClN2O4 and a molecular weight of 298.72 g/mol. IUPAC name: 6-nitrospiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride. InChIKey: JQPHRVYLIULUBI-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN2O4 |
|---|---|
| Molecular weight | 298.72 g/mol |
| IUPAC name | 6-nitrospiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride |
| InChIKey | JQPHRVYLIULUBI-UHFFFAOYSA-N |
| SMILES | C1CNCCC12CC(=O)C3=C(O2)C=CC(=C3)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)