CAS 115918-60-0 appears in our catalog under these names: L-Serine 7-amido-4-methyl coumarin hydrochloride, 97%, H-L-Ser-AMC*HCl, L-Serine 7-amido-4-methylcoumarin hydrochloride. Offered by: Chemat Brand, Creative Peptides, Biosynth. Available pack sizes: on request, 250mg, 0,25g, 0,5g, 1g, 2,5g, 5g.
(2S)-2-amino-3-hydroxy-N-(4-methyl-2-oxochromen-7-yl)propanamide;hydrochloride (CAS 115918-60-0) is a chemical compound with the molecular formula C13H15ClN2O4 and a molecular weight of 298.72 g/mol. IUPAC name: (2S)-2-amino-3-hydroxy-N-(4-methyl-2-oxochromen-7-yl)propanamide;hydrochloride. InChIKey: RUMJTWWLPLESCZ-PPHPATTJSA-N.
| Molecular formula | C13H15ClN2O4 |
|---|---|
| Molecular weight | 298.72 g/mol |
| IUPAC name | (2S)-2-amino-3-hydroxy-N-(4-methyl-2-oxochromen-7-yl)propanamide;hydrochloride |
| InChIKey | RUMJTWWLPLESCZ-PPHPATTJSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)[C@H](CO)N.Cl |
Computed by PubChem (NCBI)