CAS 1051384-06-5 is the registry number for 2-Acetyl-5-chlorophenyl trifluoromethanesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2-acetyl-5-chlorophenyl) trifluoromethanesulfonate (CAS 1051384-06-5) is a chemical compound with the molecular formula C9H6ClF3O4S and a molecular weight of 302.66 g/mol. IUPAC name: (2-acetyl-5-chlorophenyl) trifluoromethanesulfonate. InChIKey: WZUVAQGBZDTUQV-UHFFFAOYSA-N.
| Molecular formula | C9H6ClF3O4S |
|---|---|
| Molecular weight | 302.66 g/mol |
| IUPAC name | (2-acetyl-5-chlorophenyl) trifluoromethanesulfonate |
| InChIKey | WZUVAQGBZDTUQV-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1)Cl)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)