CAS 1146354-95-1 is the registry number for Methyl 3-(chlorosulfonyl)-5-(trifluoromethyl)benzoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 3-chlorosulfonyl-5-(trifluoromethyl)benzoate (CAS 1146354-95-1) is a chemical compound with the molecular formula C9H6ClF3O4S and a molecular weight of 302.66 g/mol. IUPAC name: methyl 3-chlorosulfonyl-5-(trifluoromethyl)benzoate. InChIKey: GQFHDGMNJRLMME-UHFFFAOYSA-N.
| Molecular formula | C9H6ClF3O4S |
|---|---|
| Molecular weight | 302.66 g/mol |
| IUPAC name | methyl 3-chlorosulfonyl-5-(trifluoromethyl)benzoate |
| InChIKey | GQFHDGMNJRLMME-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)S(=O)(=O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)