Products 1051418-95-1
CAS 1051418-95-1 appears in our catalog under these names: Nevirapine–d4, Nevirapine-d4 (cyclopropyl-2,2,3,3-d4), >95% (HPLC), Nevirapine-d4, Nevirapine-d4 (cyclopropyl-2,2,3,3-d4), 99 atom % D, min 98% Chemical Purity. Offered by: GLPBio, TRC, Chemat Brand, CDN, Biosynth. Available pack sizes: 1mg, 10mg, 5mg, on request, 0,01g, 0,005g, 50mg, 25mg.
7-methyl-2-(2,2,3,3-tetradeuteriocyclopropyl)-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaen-10-one (CAS 1051418-95-1) is a chemical compound with the molecular formula C15H14N4O and a molecular weight of 270.32 g/mol. IUPAC name: 7-methyl-2-(2,2,3,3-tetradeuteriocyclopropyl)-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaen-10-one. InChIKey: NQDJXKOVJZTUJA-CQOLUAMGSA-N.
| Molecular formula | C15H14N4O |
|---|---|
| Molecular weight | 270.32 g/mol |
| IUPAC name | 7-methyl-2-(2,2,3,3-tetradeuteriocyclopropyl)-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaen-10-one |
| InChIKey | NQDJXKOVJZTUJA-CQOLUAMGSA-N |
| SMILES | [2H]C1(C(C1([2H])[2H])N2C3=C(C=CC=N3)C(=O)NC4=C(C=CN=C42)C)[2H] |
Computed by PubChem (NCBI)