CAS 1847413-14-2 is the registry number for 5-Amino-4-(4-cyclopropyl-1-naphthalenyl)-2,4-dihydro-3H-1,2,4-Triazol-3-one. Offered by: TRC. Available pack sizes: 50mg.
3-amino-4-(4-cyclopropylnaphthalen-1-yl)-1H-1,2,4-triazol-5-one (CAS 1847413-14-2) is a chemical compound with the molecular formula C15H14N4O and a molecular weight of 266.30 g/mol. IUPAC name: 3-amino-4-(4-cyclopropylnaphthalen-1-yl)-1H-1,2,4-triazol-5-one. InChIKey: XULJXUNVNBBIEF-UHFFFAOYSA-N.
| Molecular formula | C15H14N4O |
|---|---|
| Molecular weight | 266.30 g/mol |
| IUPAC name | 3-amino-4-(4-cyclopropylnaphthalen-1-yl)-1H-1,2,4-triazol-5-one |
| InChIKey | XULJXUNVNBBIEF-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC=C(C3=CC=CC=C23)N4C(=NNC4=O)N |
Computed by PubChem (NCBI)