CAS 1051418-97-3 appears in our catalog under these names: Cyclopropyl-2,2,3,3-d4-amine, Cyclopropyl-2,2,3,3-d4-amine, 99 atom % D, min 98% Chemical Purity, Cyclopropyl–2,2,3,3–amine–d4, Cyclopropyl-2,2,3,3-amine-d4, 99.10%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 25mg, 50mg, 5mg, 0,25g, 0,1g, 10mg, 25 mg, 10 mg.
2,2,3,3-tetradeuteriocyclopropan-1-amine (CAS 1051418-97-3) is a chemical compound with the molecular formula C3H7N and a molecular weight of 61.12 g/mol. IUPAC name: 2,2,3,3-tetradeuteriocyclopropan-1-amine. InChIKey: HTJDQJBWANPRPF-LNLMKGTHSA-N.
| Molecular formula | C3H7N |
|---|---|
| Molecular weight | 61.12 g/mol |
| IUPAC name | 2,2,3,3-tetradeuteriocyclopropan-1-amine |
| InChIKey | HTJDQJBWANPRPF-LNLMKGTHSA-N |
| SMILES | [2H]C1(C(C1([2H])[2H])N)[2H] |
Computed by PubChem (NCBI)