CAS 153557-95-0 appears in our catalog under these names: Cyclopropyl-d5-amine, >95% (GC), Cyclopropylamine-d5, Cyclopropyl-d5-amine, 98 atom % D, min 98% Chemical Purity, Cyclopropylamine–d5, Cyclopropylamine-d5, 98.41%. Offered by: TRC, Chemat Brand, CDN, GLPBio, MedChemExpress. Available pack sizes: 100mg, 25mg, 5mg, on request, 0,25g, 0,1g, 1mg, 10mg.
1,2,2,3,3-pentadeuteriocyclopropan-1-amine (CAS 153557-95-0) is a chemical compound with the molecular formula C3H7N and a molecular weight of 62.13 g/mol. IUPAC name: 1,2,2,3,3-pentadeuteriocyclopropan-1-amine. InChIKey: HTJDQJBWANPRPF-UXXIZXEISA-N.
| Molecular formula | C3H7N |
|---|---|
| Molecular weight | 62.13 g/mol |
| IUPAC name | 1,2,2,3,3-pentadeuteriocyclopropan-1-amine |
| InChIKey | HTJDQJBWANPRPF-UXXIZXEISA-N |
| SMILES | [2H]C1(C(C1([2H])N)([2H])[2H])[2H] |
Computed by PubChem (NCBI)