CAS 105161-33-9 is the registry number for 2-Hydroxymethylene-3,3-dimethoxypropanenitrile sodium salt. Offered by: TRC. Available pack sizes: 1g.
Sodium (E)-2-cyano-3,3-dimethoxyprop-1-en-1-olate (CAS 105161-33-9) is a chemical compound with the molecular formula C6H8NNaO3 and a molecular weight of 165.12 g/mol. IUPAC name: sodium (E)-2-cyano-3,3-dimethoxyprop-1-en-1-olate. InChIKey: FOXHAHBHIMREKV-FXRZFVDSSA-M.
| Molecular formula | C6H8NNaO3 |
|---|---|
| Molecular weight | 165.12 g/mol |
| IUPAC name | sodium (E)-2-cyano-3,3-dimethoxyprop-1-en-1-olate |
| InChIKey | FOXHAHBHIMREKV-FXRZFVDSSA-M |
| SMILES | COC(/C(=C/[O-])/C#N)OC.[Na+] |
Computed by PubChem (NCBI)