CAS 118948-94-0 appears in our catalog under these names: Sodium 3-(prop-2-enamido)propanoate, 95%, Sodium 3-(prop-2-enamido)propanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
Sodium 3-(prop-2-enoylamino)propanoate (CAS 118948-94-0) is a chemical compound with the molecular formula C6H8NNaO3 and a molecular weight of 165.12 g/mol. IUPAC name: sodium 3-(prop-2-enoylamino)propanoate. InChIKey: JRFMKYAZGIDTNZ-UHFFFAOYSA-M.
| Molecular formula | C6H8NNaO3 |
|---|---|
| Molecular weight | 165.12 g/mol |
| IUPAC name | sodium 3-(prop-2-enoylamino)propanoate |
| InChIKey | JRFMKYAZGIDTNZ-UHFFFAOYSA-M |
| SMILES | C=CC(=O)NCCC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)