CAS 105191-11-5 appears in our catalog under these names: 2-Formyl-1H-indole-5-carbonitrile, 97%, 2-Formyl-1H-indole-5-carbonitrile, 97%, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
2-formyl-1H-indole-5-carbonitrile (CAS 105191-11-5) is a chemical compound with the molecular formula C10H6N2O and a molecular weight of 170.17 g/mol. IUPAC name: 2-formyl-1H-indole-5-carbonitrile. InChIKey: JKTIDDAYCYZLHY-UHFFFAOYSA-N.
| Molecular formula | C10H6N2O |
|---|---|
| Molecular weight | 170.17 g/mol |
| IUPAC name | 2-formyl-1H-indole-5-carbonitrile |
| InChIKey | JKTIDDAYCYZLHY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C#N)C=C(N2)C=O |
Computed by PubChem (NCBI)