Products 1051938-74-9

CAS 1051938-74-9 is the registry number for Undecan-6-yl acrylate, 95%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Undecan-6-yl prop-2-enoate (CAS 1051938-74-9) is a chemical compound with the molecular formula C14H26O2 and a molecular weight of 226.35 g/mol. IUPAC name: undecan-6-yl prop-2-enoate. InChIKey: IYCRNHNGNIENKQ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H26O2
Molecular weight226.35 g/mol
IUPAC nameundecan-6-yl prop-2-enoate
InChIKeyIYCRNHNGNIENKQ-UHFFFAOYSA-N
SMILESCCCCCC(CCCCC)OC(=O)C=C

Computed by PubChem (NCBI)