Products 29964-84-9

CAS 29964-84-9 is the registry number for Isodecyl methacrylate, 95%. Offered by: Combi-blocks, Sigma-Aldrich. Available pack sizes: 500g, 25g, 1kg, 100g, 5g, 1L.

Structural formula: {0} (CAS {1})

8-methylnonyl 2-methylprop-2-enoate (CAS 29964-84-9) is a chemical compound with the molecular formula C14H26O2 and a molecular weight of 226.35 g/mol. IUPAC name: 8-methylnonyl 2-methylprop-2-enoate. InChIKey: COCLLEMEIJQBAG-UHFFFAOYSA-N.

Identity
Molecular formulaC14H26O2
Molecular weight226.35 g/mol
IUPAC name8-methylnonyl 2-methylprop-2-enoate
InChIKeyCOCLLEMEIJQBAG-UHFFFAOYSA-N
SMILESCC(C)CCCCCCCOC(=O)C(=C)C

Computed by PubChem (NCBI)