CAS 126-86-3 appears in our catalog under these names: 2,4,7,9-Tetramethyl-5-decyne-4,7-diol, 97%, Decidol 98%, 2,4,7,9-Tetramethyl-5-decyne-4,7-diol (mixture of isomers), 2,4,7,9-Tetramethyl-5-decyne-4,7-diol, >95% (GC), 2,4,7,9–Tetramethyl–5–decyne–4,7–diol (DL– and meso– mixture). Offered by: Combi-blocks, Mikrochem, Dr. Ehrenstorfer, TRC, GLPBio. Available pack sizes: 5g, 100g, 500g, 1kg, 25g, 180kg, 100mg, 50g.
2,4,7,9-tetramethyldec-5-yne-4,7-diol (CAS 126-86-3) is a chemical compound with the molecular formula C14H26O2 and a molecular weight of 226.35 g/mol. IUPAC name: 2,4,7,9-tetramethyldec-5-yne-4,7-diol. InChIKey: LXOFYPKXCSULTL-UHFFFAOYSA-N.
| Molecular formula | C14H26O2 |
|---|---|
| Molecular weight | 226.35 g/mol |
| IUPAC name | 2,4,7,9-tetramethyldec-5-yne-4,7-diol |
| InChIKey | LXOFYPKXCSULTL-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C)(C#CC(C)(CC(C)C)O)O |
Computed by PubChem (NCBI)