CAS 105229-16-1 is the registry number for (alphaS,betaR)-alpha-Amino-beta-hydroxy-1,3-benzodioxole-5-methyl Propanoate. Offered by: TRC. Available pack sizes: 100mg.
Methyl (2S,3R)-2-amino-3-(1,3-benzodioxol-5-yl)-3-hydroxypropanoate (CAS 105229-16-1) is a chemical compound with the molecular formula C11H13NO5 and a molecular weight of 239.22 g/mol. IUPAC name: methyl (2S,3R)-2-amino-3-(1,3-benzodioxol-5-yl)-3-hydroxypropanoate. InChIKey: KOJZVFSYXKKGAM-VHSXEESVSA-N.
| Molecular formula | C11H13NO5 |
|---|---|
| Molecular weight | 239.22 g/mol |
| IUPAC name | methyl (2S,3R)-2-amino-3-(1,3-benzodioxol-5-yl)-3-hydroxypropanoate |
| InChIKey | KOJZVFSYXKKGAM-VHSXEESVSA-N |
| SMILES | COC(=O)[C@H]([C@@H](C1=CC2=C(C=C1)OCO2)O)N |
Computed by PubChem (NCBI)