Products 145352-75-6
CAS 145352-75-6 appears in our catalog under these names: 2-(Acetylamino)-4,5-dimethoxybenzoic acid, 95%, 2-Acetamido-4,5-dimethoxybenzoic acid, 2-Acetamido-4,5-dimethoxybenzoic acid 97%, 2-Acetamido-4,5-dimethoxybenzoic acid, 97%, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
2-acetamido-4,5-dimethoxybenzoic acid (CAS 145352-75-6) is a chemical compound with the molecular formula C11H13NO5 and a molecular weight of 239.22 g/mol. IUPAC name: 2-acetamido-4,5-dimethoxybenzoic acid. InChIKey: GFIPYKUNLSFXTQ-UHFFFAOYSA-N.
| Molecular formula | C11H13NO5 |
|---|---|
| Molecular weight | 239.22 g/mol |
| IUPAC name | 2-acetamido-4,5-dimethoxybenzoic acid |
| InChIKey | GFIPYKUNLSFXTQ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1C(=O)O)OC)OC |
Computed by PubChem (NCBI)