CAS 105249-35-2 is the registry number for cis-Cyclohex-4-ene-1,2-diamine dihydrochloride, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg.
(1S,2R)-cyclohex-4-ene-1,2-diamine;dihydrochloride (CAS 105249-35-2) is a chemical compound with the molecular formula C6H14Cl2N2 and a molecular weight of 185.09 g/mol. IUPAC name: (1S,2R)-cyclohex-4-ene-1,2-diamine;dihydrochloride. InChIKey: UQRRHSHMGMLJDM-RUTFAPCESA-N.
| Molecular formula | C6H14Cl2N2 |
|---|---|
| Molecular weight | 185.09 g/mol |
| IUPAC name | (1S,2R)-cyclohex-4-ene-1,2-diamine;dihydrochloride |
| InChIKey | UQRRHSHMGMLJDM-RUTFAPCESA-N |
| SMILES | C1C=CC[C@@H]([C@@H]1N)N.Cl.Cl |
Computed by PubChem (NCBI)