Products 1052542-93-4

CAS 1052542-93-4 is the registry number for Methyl 2-(chloromethyl)-4-phenylquinoline-3-carboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

Methyl 2-(chloromethyl)-4-phenylquinoline-3-carboxylate;hydrochloride (CAS 1052542-93-4) is a chemical compound with the molecular formula C18H15Cl2NO2 and a molecular weight of 348.2 g/mol. IUPAC name: methyl 2-(chloromethyl)-4-phenylquinoline-3-carboxylate;hydrochloride. InChIKey: FMGWRXCQHDBSCP-UHFFFAOYSA-N.

Identity
Molecular formulaC18H15Cl2NO2
Molecular weight348.2 g/mol
IUPAC namemethyl 2-(chloromethyl)-4-phenylquinoline-3-carboxylate;hydrochloride
InChIKeyFMGWRXCQHDBSCP-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C2=CC=CC=C2N=C1CCl)C3=CC=CC=C3.Cl

Computed by PubChem (NCBI)