Products 2413006-62-7
CAS 2413006-62-7 is the registry number for Antibacterial agent 96. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(3,4-dichlorophenyl)methoxy]-6-methoxy-2-methylquinoline (CAS 2413006-62-7) is a chemical compound with the molecular formula C18H15Cl2NO2 and a molecular weight of 348.2 g/mol. IUPAC name: 4-[(3,4-dichlorophenyl)methoxy]-6-methoxy-2-methylquinoline. InChIKey: LNOPPGNOTHHPQA-UHFFFAOYSA-N.
| Molecular formula | C18H15Cl2NO2 |
|---|---|
| Molecular weight | 348.2 g/mol |
| IUPAC name | 4-[(3,4-dichlorophenyl)methoxy]-6-methoxy-2-methylquinoline |
| InChIKey | LNOPPGNOTHHPQA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=C(C=CC2=N1)OC)OCC3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
Antibacterial agent 96, orb1688868