CAS 1052546-14-1 is the registry number for Methyl 3-(4-aminobenzenesulfonamido)propanoate hydrochloride. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
Methyl 3-[(4-aminophenyl)sulfonylamino]propanoate;hydrochloride (CAS 1052546-14-1) is a chemical compound with the molecular formula C10H15ClN2O4S and a molecular weight of 294.76 g/mol. IUPAC name: methyl 3-[(4-aminophenyl)sulfonylamino]propanoate;hydrochloride. InChIKey: CMDLLWJWIWOCKM-UHFFFAOYSA-N.
| Molecular formula | C10H15ClN2O4S |
|---|---|
| Molecular weight | 294.76 g/mol |
| IUPAC name | methyl 3-[(4-aminophenyl)sulfonylamino]propanoate;hydrochloride |
| InChIKey | CMDLLWJWIWOCKM-UHFFFAOYSA-N |
| SMILES | COC(=O)CCNS(=O)(=O)C1=CC=C(C=C1)N.Cl |
Computed by PubChem (NCBI)