Products 1052546-14-1

CAS 1052546-14-1 is the registry number for Methyl 3-(4-aminobenzenesulfonamido)propanoate hydrochloride. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

Methyl 3-[(4-aminophenyl)sulfonylamino]propanoate;hydrochloride (CAS 1052546-14-1) is a chemical compound with the molecular formula C10H15ClN2O4S and a molecular weight of 294.76 g/mol. IUPAC name: methyl 3-[(4-aminophenyl)sulfonylamino]propanoate;hydrochloride. InChIKey: CMDLLWJWIWOCKM-UHFFFAOYSA-N.

Identity
Molecular formulaC10H15ClN2O4S
Molecular weight294.76 g/mol
IUPAC namemethyl 3-[(4-aminophenyl)sulfonylamino]propanoate;hydrochloride
InChIKeyCMDLLWJWIWOCKM-UHFFFAOYSA-N
SMILESCOC(=O)CCNS(=O)(=O)C1=CC=C(C=C1)N.Cl

Computed by PubChem (NCBI)