Products 1829467-65-3

CAS 1829467-65-3 is the registry number for Methyl 2-(N-(2-aminoethyl)sulfamoyl)benzoate hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 2-(2-aminoethylsulfamoyl)benzoate;hydrochloride (CAS 1829467-65-3) is a chemical compound with the molecular formula C10H15ClN2O4S and a molecular weight of 294.76 g/mol. IUPAC name: methyl 2-(2-aminoethylsulfamoyl)benzoate;hydrochloride. InChIKey: HQVYEEUDACLVJD-UHFFFAOYSA-N.

Identity
Molecular formulaC10H15ClN2O4S
Molecular weight294.76 g/mol
IUPAC namemethyl 2-(2-aminoethylsulfamoyl)benzoate;hydrochloride
InChIKeyHQVYEEUDACLVJD-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=CC=C1S(=O)(=O)NCCN.Cl

Computed by PubChem (NCBI)